Inorganic Salts
Filtered Search Results
Ammonium hydroxide, 28% NH3
CAS: 1336-21-6 Molecular Formula: H5NO Molecular Weight (g/mol): 35.05 MDL Number: MFCD00066650 InChI Key: VHUUQVKOLVNVRT-UHFFFAOYSA-N Synonym: ammonium hydroxide,ammonia water,ammonia aqueous,aquammonia,aqua ammonia,ammonia, aqua,household ammonia,ammonium hydroxide solution,ammonia, monohydrate,ammonium hydroxide nh4 oh PubChem CID: 14923 ChEBI: CHEBI:18219 IUPAC Name: azanium;hydroxide SMILES: N.O
| PubChem CID | 14923 |
|---|---|
| CAS | 1336-21-6 |
| Molecular Weight (g/mol) | 35.05 |
| ChEBI | CHEBI:18219 |
| MDL Number | MFCD00066650 |
| SMILES | N.O |
| Synonym | ammonium hydroxide,ammonia water,ammonia aqueous,aquammonia,aqua ammonia,ammonia, aqua,household ammonia,ammonium hydroxide solution,ammonia, monohydrate,ammonium hydroxide nh4 oh |
| IUPAC Name | azanium;hydroxide |
| InChI Key | VHUUQVKOLVNVRT-UHFFFAOYSA-N |
| Molecular Formula | H5NO |
Manganese(II) chloride tetrahydrate, ACS reagent
CAS: 13446-34-9 Molecular Formula: Cl2H8MnO4 Molecular Weight (g/mol): 197.90 MDL Number: MFCD00149792 InChI Key: CNFDGXZLMLFIJV-UHFFFAOYSA-L IUPAC Name: manganese(2+) tetrahydrate dichloride SMILES: O.O.O.O.[Cl-].[Cl-].[Mn++]
| CAS | 13446-34-9 |
|---|---|
| Molecular Weight (g/mol) | 197.90 |
| MDL Number | MFCD00149792 |
| SMILES | O.O.O.O.[Cl-].[Cl-].[Mn++] |
| IUPAC Name | manganese(2+) tetrahydrate dichloride |
| InChI Key | CNFDGXZLMLFIJV-UHFFFAOYSA-L |
| Molecular Formula | Cl2H8MnO4 |
Copper(II)-ethylenediamine complex, 1M solution in water
CAS: 14552-35-3 | C4H18CuN4O2 | 217.76 g/mol
| Linear Formula | Cu(H2NCH2CH2NH2)2(OH)2 |
|---|---|
| Molecular Weight (g/mol) | 217.76 |
| Chemical Name or Material | Copper(II)-ethylenediamine complex |
| Density | 1.1000g/mL |
| Name Note | 1M Solution in Water |
| CAS | 7732-18-5 |
| Health Hazard 3 | GHS P Statement IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Wear eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Continue rinsi |
| MDL Number | MFCD00274628 |
| Health Hazard 2 | GHS H Statement Causes severe skin burns and eye damage. |
| Packaging | Glass bottle |
| Solubility Information | Solubility in water: soluble |
| Flash Point | >110°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | Bis(ethylenediamine)copper(II)hydroxide |
| TSCA | TSCA |
| Molecular Formula | C4H18CuN4O2 |
| EINECS Number | 238-597-7 |
| Formula Weight | 217.76 |
| Specific Gravity | 1.1 |
Sodium chlorite, tech. nominally 80%
CAS: 7758-19-2 MDL Number: MFCD00003478 IUPAC Name: sodium;chlorite
| CAS | 7758-19-2 |
|---|---|
| MDL Number | MFCD00003478 |
| IUPAC Name | sodium;chlorite |
Copper(II) nitrate trihydrate, 99%, for analysis
CAS: 10031-43-3 MDL Number: MFCD00149671 InChI Key: SXTLQDJHRPXDSB-UHFFFAOYSA-N Synonym: copper ii nitrate trihydrate,copper nitrate trihydrate,cupric nitrate trihydrate,copper ii nitrate hydrate,copper ii nitrate 3-hydrate,copper 2+ trihydrate dinitronate,copper 2+ trihydrate dinitrate,copper ii nitrate trihydrate-cu puratrem PubChem CID: 9837674 IUPAC Name: copper;dinitrate;trihydrate SMILES: [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].O.O.O.[Cu+2]
| PubChem CID | 9837674 |
|---|---|
| CAS | 10031-43-3 |
| MDL Number | MFCD00149671 |
| SMILES | [N+](=O)([O-])[O-].[N+](=O)([O-])[O-].O.O.O.[Cu+2] |
| Synonym | copper ii nitrate trihydrate,copper nitrate trihydrate,cupric nitrate trihydrate,copper ii nitrate hydrate,copper ii nitrate 3-hydrate,copper 2+ trihydrate dinitronate,copper 2+ trihydrate dinitrate,copper ii nitrate trihydrate-cu puratrem |
| IUPAC Name | copper;dinitrate;trihydrate |
| InChI Key | SXTLQDJHRPXDSB-UHFFFAOYSA-N |
Potassium sodium tartrate tetrahydrate, ACS reagent
CAS: 6381-59-5 Molecular Formula: C4H4KNaO6·4H2O Molecular Weight (g/mol): 282.22 InChI Key: VZOPRCCTKLAGPN-UHFFFAOYSA-L Synonym: potassium sodium tartrate tetrahydrate,sodium potassium tartrate tetrahydrate,monopotassium monosodium tartrate tetrahydrate,sodiumpotassiumtartrate,tetr,potassium sodium 2,3-dihydroxybutanedioate tetrahydrate,potassium sodium tetrahydrate tartrate,l +-tartaric acid potassium sodium salt,acmc-209nif,acmc-20aju8,ksc493o7j PubChem CID: 2724148 IUPAC Name: potassium;sodium;2,3-dihydroxybutanedioate;tetrahydrate SMILES: C(C(C(=O)[O-])O)(C(=O)[O-])O.O.O.O.O.[Na+].[K+]
| PubChem CID | 2724148 |
|---|---|
| CAS | 6381-59-5 |
| Molecular Weight (g/mol) | 282.22 |
| SMILES | C(C(C(=O)[O-])O)(C(=O)[O-])O.O.O.O.O.[Na+].[K+] |
| Synonym | potassium sodium tartrate tetrahydrate,sodium potassium tartrate tetrahydrate,monopotassium monosodium tartrate tetrahydrate,sodiumpotassiumtartrate,tetr,potassium sodium 2,3-dihydroxybutanedioate tetrahydrate,potassium sodium tetrahydrate tartrate,l +-tartaric acid potassium sodium salt,acmc-209nif,acmc-20aju8,ksc493o7j |
| IUPAC Name | potassium;sodium;2,3-dihydroxybutanedioate;tetrahydrate |
| InChI Key | VZOPRCCTKLAGPN-UHFFFAOYSA-L |
| Molecular Formula | C4H4KNaO6·4H2O |
Potassium Chloride, 99+%, ACS Reagent
CAS: 7447-40-7 Molecular Formula: ClK Molecular Weight (g/mol): 74.55 MDL Number: MFCD00011360 InChI Key: WCUXLLCKKVVCTQ-UHFFFAOYSA-M Synonym: potassium chloride,enseal,muriate of potash,klotrix,sylvite,slow-k,potassium chloride kcl,klor-con,chlorvescent,kalitabs PubChem CID: 4873 ChEBI: CHEBI:32588 SMILES: [Cl-].[K+]
| PubChem CID | 4873 |
|---|---|
| CAS | 7447-40-7 |
| Molecular Weight (g/mol) | 74.55 |
| ChEBI | CHEBI:32588 |
| MDL Number | MFCD00011360 |
| SMILES | [Cl-].[K+] |
| Synonym | potassium chloride,enseal,muriate of potash,klotrix,sylvite,slow-k,potassium chloride kcl,klor-con,chlorvescent,kalitabs |
| InChI Key | WCUXLLCKKVVCTQ-UHFFFAOYSA-M |
| Molecular Formula | ClK |
Sodium sulfate, 99%, extra pure, anhydrous
CAS: 7757-82-6 Molecular Formula: Na2O4S Molecular Weight (g/mol): 142.04 MDL Number: MFCD00003504 InChI Key: PMZURENOXWZQFD-UHFFFAOYSA-L Synonym: sodium sulfate,disodium sulfate,salt cake,thenardite,sodium sulfate anhydrous,sodium sulphate,sodium sulfate, anhydrous,sulfuric acid disodium salt,disodium sulphate,sodium sulfate 2:1 PubChem CID: 24436 ChEBI: CHEBI:32149 SMILES: [Na+].[Na+].[O-]S([O-])(=O)=O
| PubChem CID | 24436 |
|---|---|
| CAS | 7757-82-6 |
| Molecular Weight (g/mol) | 142.04 |
| ChEBI | CHEBI:32149 |
| MDL Number | MFCD00003504 |
| SMILES | [Na+].[Na+].[O-]S([O-])(=O)=O |
| Synonym | sodium sulfate,disodium sulfate,salt cake,thenardite,sodium sulfate anhydrous,sodium sulphate,sodium sulfate, anhydrous,sulfuric acid disodium salt,disodium sulphate,sodium sulfate 2:1 |
| InChI Key | PMZURENOXWZQFD-UHFFFAOYSA-L |
| Molecular Formula | Na2O4S |
Sodium bicarbonate, 99.5%, for analysis
CAS: 144-55-8 Molecular Formula: CHNaO3 Molecular Weight (g/mol): 84.01 MDL Number: MFCD00003528 InChI Key: UIIMBOGNXHQVGW-UHFFFAOYSA-M Synonym: sodium bicarbonate,sodium hydrogen carbonate,baking soda,carbonic acid monosodium salt,sodium acid carbonate,bicarbonate of soda,sodium hydrogencarbonate,meylon,acidosan,neut PubChem CID: 516892 ChEBI: CHEBI:32139 SMILES: [Na+].OC([O-])=O
| PubChem CID | 516892 |
|---|---|
| CAS | 144-55-8 |
| Molecular Weight (g/mol) | 84.01 |
| ChEBI | CHEBI:32139 |
| MDL Number | MFCD00003528 |
| SMILES | [Na+].OC([O-])=O |
| Synonym | sodium bicarbonate,sodium hydrogen carbonate,baking soda,carbonic acid monosodium salt,sodium acid carbonate,bicarbonate of soda,sodium hydrogencarbonate,meylon,acidosan,neut |
| InChI Key | UIIMBOGNXHQVGW-UHFFFAOYSA-M |
| Molecular Formula | CHNaO3 |
Hydrazine sulfate, ACS reagent
CAS: 10034-93-2 Molecular Formula: H4N2·H2SO4 Molecular Weight (g/mol): 130.12 MDL Number: MFCD00044873 InChI Key: ZGCHATBSUIJLRL-UHFFFAOYSA-N Synonym: hydrazine sulfate,hydrazine monosulfate,hydrazine, sulfate,hydrazine sulphate,hydrazinium sulfate,hydrazonium sulfate,hydrazine sulfate 1:1,segidrin,sehydrin,diamine sulfate PubChem CID: 24842 IUPAC Name: hydrazine;sulfuric acid SMILES: NN.OS(=O)(=O)O
| PubChem CID | 24842 |
|---|---|
| CAS | 10034-93-2 |
| Molecular Weight (g/mol) | 130.12 |
| MDL Number | MFCD00044873 |
| SMILES | NN.OS(=O)(=O)O |
| Synonym | hydrazine sulfate,hydrazine monosulfate,hydrazine, sulfate,hydrazine sulphate,hydrazinium sulfate,hydrazonium sulfate,hydrazine sulfate 1:1,segidrin,sehydrin,diamine sulfate |
| IUPAC Name | hydrazine;sulfuric acid |
| InChI Key | ZGCHATBSUIJLRL-UHFFFAOYSA-N |
| Molecular Formula | H4N2·H2SO4 |
Lead(II) nitrate, 99+%, ACS reagent
CAS: 10099-74-8 Molecular Formula: N2O6Pb Molecular Weight (g/mol): 331.20 MDL Number: MFCD00011153 InChI Key: RLJMLMKIBZAXJO-UHFFFAOYSA-N Synonym: lead dinitrate,lead nitrate,lead ii nitrate,plumbous nitrate,lead 2+ nitrate,lead nitrate pb no3 2,nitrate de plomb french,lead ii nitrate 1:2,nitric acid, lead 2+ salt PubChem CID: 24924 ChEBI: CHEBI:37187 SMILES: [Pb++].[O-][N+]([O-])=O.[O-][N+]([O-])=O
| PubChem CID | 24924 |
|---|---|
| CAS | 10099-74-8 |
| Molecular Weight (g/mol) | 331.20 |
| ChEBI | CHEBI:37187 |
| MDL Number | MFCD00011153 |
| SMILES | [Pb++].[O-][N+]([O-])=O.[O-][N+]([O-])=O |
| Synonym | lead dinitrate,lead nitrate,lead ii nitrate,plumbous nitrate,lead 2+ nitrate,lead nitrate pb no3 2,nitrate de plomb french,lead ii nitrate 1:2,nitric acid, lead 2+ salt |
| InChI Key | RLJMLMKIBZAXJO-UHFFFAOYSA-N |
| Molecular Formula | N2O6Pb |
Potassium iodate, ACS, 99.4-100.4%
CAS: 5-6-7758 Molecular Formula: IKO3 Molecular Weight (g/mol): 214.00 MDL Number: MFCD00011406 InChI Key: JLKDVMWYMMLWTI-UHFFFAOYSA-M Synonym: potassium iodate,potassium triodate,caswell no. 693a,iodic acid, potassium salt,unii-i139e44nhl,potassium iodine oxide kio3,iodic acid hio3 , potassium salt,epa pesticide chemical code 075703,iodic acid hio3 , potassium salt 1:1,kaliumjodat PubChem CID: 23665710 IUPAC Name: potassium;iodate SMILES: [O-]I(=O)=O.[K+]
| PubChem CID | 23665710 |
|---|---|
| CAS | 5-6-7758 |
| Molecular Weight (g/mol) | 214.00 |
| MDL Number | MFCD00011406 |
| SMILES | [O-]I(=O)=O.[K+] |
| Synonym | potassium iodate,potassium triodate,caswell no. 693a,iodic acid, potassium salt,unii-i139e44nhl,potassium iodine oxide kio3,iodic acid hio3 , potassium salt,epa pesticide chemical code 075703,iodic acid hio3 , potassium salt 1:1,kaliumjodat |
| IUPAC Name | potassium;iodate |
| InChI Key | JLKDVMWYMMLWTI-UHFFFAOYSA-M |
| Molecular Formula | IKO3 |
Calcium phosphate, 96%, pure, mixture of Calcium phosphates
CAS: 7758-87-4 Molecular Formula: Ca3O8P2 Molecular Weight (g/mol): 310.18 InChI Key: QORWJWZARLRLPR-UHFFFAOYSA-H Synonym: calcium phosphate,synthos,tricalcium phosphate,tricalcium diphosphate,calcigenol simple,calcium orthophosphate,beta-tcp,tribasic calcium phosphate,bonarka,calcium phosphate, tribasic PubChem CID: 24456 ChEBI: CHEBI:9679 IUPAC Name: tricalcium;diphosphate SMILES: [O-]P(=O)([O-])[O-].[O-]P(=O)([O-])[O-].[Ca+2].[Ca+2].[Ca+2]
| PubChem CID | 24456 |
|---|---|
| CAS | 7758-87-4 |
| Molecular Weight (g/mol) | 310.18 |
| ChEBI | CHEBI:9679 |
| SMILES | [O-]P(=O)([O-])[O-].[O-]P(=O)([O-])[O-].[Ca+2].[Ca+2].[Ca+2] |
| Synonym | calcium phosphate,synthos,tricalcium phosphate,tricalcium diphosphate,calcigenol simple,calcium orthophosphate,beta-tcp,tribasic calcium phosphate,bonarka,calcium phosphate, tribasic |
| IUPAC Name | tricalcium;diphosphate |
| InChI Key | QORWJWZARLRLPR-UHFFFAOYSA-H |
| Molecular Formula | Ca3O8P2 |
Calcium hydroxide, ACS, 95.0% min
CAS: 1305-62-0 Molecular Formula: CaH2O2 Molecular Weight (g/mol): 74.09 MDL Number: MFCD00010901 InChI Key: AXCZMVOFGPJBDE-UHFFFAOYSA-L Synonym: calcium hydroxide,slaked lime,hydrated lime,calcium dihydroxide,calcium ii hydroxide,calcium oxide, hydrated,kalziumhydroxid,loeschkalk,pickling lime,calciumdihydroxid PubChem CID: 6093208 ChEBI: CHEBI:31341 SMILES: [OH-].[OH-].[Ca++]
| PubChem CID | 6093208 |
|---|---|
| CAS | 1305-62-0 |
| Molecular Weight (g/mol) | 74.09 |
| ChEBI | CHEBI:31341 |
| MDL Number | MFCD00010901 |
| SMILES | [OH-].[OH-].[Ca++] |
| Synonym | calcium hydroxide,slaked lime,hydrated lime,calcium dihydroxide,calcium ii hydroxide,calcium oxide, hydrated,kalziumhydroxid,loeschkalk,pickling lime,calciumdihydroxid |
| InChI Key | AXCZMVOFGPJBDE-UHFFFAOYSA-L |
| Molecular Formula | CaH2O2 |
Potassium pyrosulfate, 98%, for analysis
CAS: 7790-62-7 Molecular Formula: K2O7S2 Molecular Weight (g/mol): 254.31 InChI Key: KAQHZJVQFBJKCK-UHFFFAOYSA-L Synonym: potassium pyrosulfate,dipotassium disulfate,potassium disulfate,unii-avj6zst7l6,avj6zst7l6,disulfuric acid dipotassium salt,dipotassium sulfonato sulfate,dipotassium disulphate,dipotassium pyrosulfate,kaliumpyrosulfat PubChem CID: 62681 IUPAC Name: dipotassium;sulfonato sulfate SMILES: [O-]S(=O)(=O)OS(=O)(=O)[O-].[K+].[K+]
| PubChem CID | 62681 |
|---|---|
| CAS | 7790-62-7 |
| Molecular Weight (g/mol) | 254.31 |
| SMILES | [O-]S(=O)(=O)OS(=O)(=O)[O-].[K+].[K+] |
| Synonym | potassium pyrosulfate,dipotassium disulfate,potassium disulfate,unii-avj6zst7l6,avj6zst7l6,disulfuric acid dipotassium salt,dipotassium sulfonato sulfate,dipotassium disulphate,dipotassium pyrosulfate,kaliumpyrosulfat |
| IUPAC Name | dipotassium;sulfonato sulfate |
| InChI Key | KAQHZJVQFBJKCK-UHFFFAOYSA-L |
| Molecular Formula | K2O7S2 |